C30H49F3NO5P — CID 143869101
ditert-butyl [2-methyl-4-[2-[4-(6-methylheptoxy)-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite (PubChem CID 143869101) has the molecular formula C30H49F3NO5P and a molecular weight of 591.69 g/mol. Its IUPAC name is ditert-butyl [2-methyl-4-[2-[4-(6-methylheptoxy)-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite.
| Compound Name | ditert-butyl [2-methyl-4-[2-[4-(6-methylheptoxy)-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite |
|---|---|
| PubChem CID | 143869101 |
| Molecular Formula | C30H49F3NO5P |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | ditert-butyl [2-methyl-4-[2-[4-(6-methylheptoxy)-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphite |
| SMILES | CC1=NC(CCc2ccc(OCCCCCC(C)C)c(C(F)(F)F)c2)(COP(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C30H49F3NO5P/c1-22(2)13-11-10-12-18-35-26-15-14-24(19-25(26)30(31,32)33)16-17-29(20-36-23(3)34-29)21-37-40(38-27(4,5)6)39-28(7,8)9/h14-15,19,22H,10-13,16-18,20-21H2,1-9H3 |
| InChIKey | ZHRXDVSHJKNVOJ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|