C29H45F3NO6P — CID 70963718
ditert-butyl [4-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 70963718) has the molecular formula C29H45F3NO6P and a molecular weight of 591.65 g/mol. Its IUPAC name is ditert-butyl [4-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [4-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 70963718 |
| Molecular Formula | C29H45F3NO6P |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | ditert-butyl [4-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CCCC/C=C/COc1ccc(CCC2(COP(=O)(OC(C)(C)C)OC(C)(C)C)COC(C)=N2)cc1C(F)(F)F |
| InChI | InChI=1S/C29H45F3NO6P/c1-9-10-11-12-13-18-35-25-15-14-23(19-24(25)29(30,31)32)16-17-28(20-36-22(2)33-28)21-37-40(34,38-26(3,4)5)39-27(6,7)8/h12-15,19H,9-11,16-18,20-21H2,1-8H3/b13-12+ |
| InChIKey | HMAFJFGKTSCENF-OUKQBFOZSA-N |
| XLogP | 8.71 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|