C31H42ClF3NO6P — CID 59407874
ditert-butyl [4-[2-[4-[3-(3-chlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 59407874) has the molecular formula C31H42ClF3NO6P and a molecular weight of 648.10 g/mol. Its IUPAC name is ditert-butyl [4-[2-[4-[3-(3-chlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [4-[2-[4-[3-(3-chlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 59407874 |
| Molecular Formula | C31H42ClF3NO6P |
| Molecular Weight | 648.10 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | ditert-butyl [4-[2-[4-[3-(3-chlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CC1=NC(CCc2ccc(OCCCc3cccc(Cl)c3)c(C(F)(F)F)c2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C31H42ClF3NO6P/c1-22-36-30(20-39-22,21-40-43(37,41-28(2,3)4)42-29(5,6)7)16-15-24-13-14-27(26(19-24)31(33,34)35)38-17-9-11-23-10-8-12-25(32)18-23/h8,10,12-14,18-19H,9,11,15-17,20-21H2,1-7H3 |
| InChIKey | QCFIPUUVPLGYCB-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.10 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|