C35H48F6NO7P — CID 59407773
ditert-butyl [(4R)-7,7-dimethyl-2-oxo-4-[2-[3-(trifluoromethyl)-4-[3-[4-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]-1,3-oxazepan-4-yl]methyl phosphate (PubChem CID 59407773) has the molecular formula C35H48F6NO7P and a molecular weight of 739.73 g/mol. Its IUPAC name is ditert-butyl [(4R)-7,7-dimethyl-2-oxo-4-[2-[3-(trifluoromethyl)-4-[3-[4-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]-1,3-oxazepan-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [(4R)-7,7-dimethyl-2-oxo-4-[2-[3-(trifluoromethyl)-4-[3-[4-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]-1,3-oxazepan-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 59407773 |
| Molecular Formula | C35H48F6NO7P |
| Molecular Weight | 739.73 g/mol |
| Exact Mass | 739.31 |
| IUPAC Name | ditert-butyl [(4R)-7,7-dimethyl-2-oxo-4-[2-[3-(trifluoromethyl)-4-[3-[4-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]-1,3-oxazepan-4-yl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC[C@@]1(CCc2ccc(OCCCc3ccc(C(F)(F)F)cc3)c(C(F)(F)F)c2)CCC(C)(C)OC(=O)N1)OC(C)(C)C |
| InChI | InChI=1S/C35H48F6NO7P/c1-30(2,3)48-50(44,49-31(4,5)6)46-23-33(20-19-32(7,8)47-29(43)42-33)18-17-25-13-16-28(27(22-25)35(39,40)41)45-21-9-10-24-11-14-26(15-12-24)34(36,37)38/h11-16,22H,9-10,17-21,23H2,1-8H3,(H,42,43)/t33-/m1/s1 |
| InChIKey | RTYFWWUFJWRFCE-MGBGTMOVSA-N |
| XLogP | 10.46 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.73 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|