C32H44F4NO6P — CID 59407612
ditert-butyl [4-[2-[4-[3-(4-fluoro-3-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 59407612) has the molecular formula C32H44F4NO6P and a molecular weight of 645.67 g/mol. Its IUPAC name is ditert-butyl [4-[2-[4-[3-(4-fluoro-3-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [4-[2-[4-[3-(4-fluoro-3-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 59407612 |
| Molecular Formula | C32H44F4NO6P |
| Molecular Weight | 645.67 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | ditert-butyl [4-[2-[4-[3-(4-fluoro-3-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CC1=NC(CCc2ccc(OCCCc3ccc(F)c(C)c3)c(C(F)(F)F)c2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C32H44F4NO6P/c1-22-18-24(11-13-27(22)33)10-9-17-39-28-14-12-25(19-26(28)32(34,35)36)15-16-31(20-40-23(2)37-31)21-41-44(38,42-29(3,4)5)43-30(6,7)8/h11-14,18-19H,9-10,15-17,20-21H2,1-8H3 |
| InChIKey | PZSMXYVLBDHJLW-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.67 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|