C22H31F3NO3- — CID 143486199
[2-methyl-4-[2-[4-octoxy-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanolate (PubChem CID 143486199) has the molecular formula C22H31F3NO3- and a molecular weight of 414.49 g/mol. Its IUPAC name is [2-methyl-4-[2-[4-octoxy-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanolate.
| Compound Name | [2-methyl-4-[2-[4-octoxy-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanolate |
|---|---|
| PubChem CID | 143486199 |
| Molecular Formula | C22H31F3NO3- |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | [2-methyl-4-[2-[4-octoxy-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanolate |
| SMILES | CCCCCCCCOc1ccc(CCC2(C[O-])COC(C)=N2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H31F3NO3/c1-3-4-5-6-7-8-13-28-20-10-9-18(14-19(20)22(23,24)25)11-12-21(15-27)16-29-17(2)26-21/h9-10,14H,3-8,11-13,15-16H2,1-2H3/q-1 |
| InChIKey | IHFLKAGCQHDEJU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|