C29H39F3NO6P — CID 146956733
tert-butyl [4-[2-[4-[3-(4-ethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate (PubChem CID 146956733) has the molecular formula C29H39F3NO6P and a molecular weight of 585.60 g/mol. Its IUPAC name is tert-butyl [4-[2-[4-[3-(4-ethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate.
| Compound Name | tert-butyl [4-[2-[4-[3-(4-ethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 146956733 |
| Molecular Formula | C29H39F3NO6P |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | tert-butyl [4-[2-[4-[3-(4-ethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate |
| SMILES | CCc1ccc(CCCOc2ccc(CCC3(COP(=O)(O)OC(C)(C)C)COC(C)=N3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H39F3NO6P/c1-6-22-9-11-23(12-10-22)8-7-17-36-26-14-13-24(18-25(26)29(30,31)32)15-16-28(19-37-21(2)33-28)20-38-40(34,35)39-27(3,4)5/h9-14,18H,6-8,15-17,19-20H2,1-5H3,(H,34,35) |
| InChIKey | AJUBKIKFQARFOR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|