C32H45F3NO6P — CID 59407501
ditert-butyl [2-methyl-4-[2-[4-[3-(2-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate (PubChem CID 59407501) has the molecular formula C32H45F3NO6P and a molecular weight of 627.68 g/mol. Its IUPAC name is ditert-butyl [2-methyl-4-[2-[4-[3-(2-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate.
| Compound Name | ditert-butyl [2-methyl-4-[2-[4-[3-(2-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 59407501 |
| Molecular Formula | C32H45F3NO6P |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | ditert-butyl [2-methyl-4-[2-[4-[3-(2-methylphenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methyl phosphate |
| SMILES | CC1=NC(CCc2ccc(OCCCc3ccccc3C)c(C(F)(F)F)c2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C32H45F3NO6P/c1-23-12-9-10-13-26(23)14-11-19-38-28-16-15-25(20-27(28)32(33,34)35)17-18-31(21-39-24(2)36-31)22-40-43(37,41-29(3,4)5)42-30(6,7)8/h9-10,12-13,15-16,20H,11,14,17-19,21-22H2,1-8H3 |
| InChIKey | BCNALCWKOBCHCS-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|