C23H28N2O5S2 — CID 121324450
[(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 121324450) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 121324450 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC(C)(C)C(=O)/C(=N\OS(=O)(=O)CC12CCC(CC1=O)C2(C)C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H28N2O5S2/c1-21(2,3)19(27)18(20-24-15-8-6-7-9-16(15)31-20)25-30-32(28,29)13-23-11-10-14(12-17(23)26)22(23,4)5/h6-9,14H,10-13H2,1-5H3/b25-18+ |
| InChIKey | DDYSDKXPBQMNOT-XIEYBQDHSA-N |
| XLogP | 4.36 |
| TPSA | 102.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|