C22H26N2O5S2 — CID 121324436
[(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7-methyl-2-oxo-7-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 121324436) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7-methyl-2-oxo-7-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7-methyl-2-oxo-7-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 121324436 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3,3-dimethyl-2-oxobutylidene]amino] (7-methyl-2-oxo-7-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC(C)(C)C(=O)/C(=N\OS(=O)(=O)CC1(C)C2CCC1C(=O)C2)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H26N2O5S2/c1-21(2,3)19(26)18(20-23-15-7-5-6-8-17(15)30-20)24-29-31(27,28)12-22(4)13-9-10-14(22)16(25)11-13/h5-8,13-14H,9-12H2,1-4H3/b24-18+ |
| InChIKey | NZLCNYWVQQPKIT-HKOYGPOVSA-N |
| XLogP | 3.97 |
| TPSA | 102.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|