C23H26N2O4S2 — CID 118099513
[(E)-[1-(1,3-benzothiazol-2-yl)-3-ethyl-2-oxoheptylidene]amino] 4-methylbenzenesulfonate (PubChem CID 118099513) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is [(E)-[1-(1,3-benzothiazol-2-yl)-3-ethyl-2-oxoheptylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3-ethyl-2-oxoheptylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118099513 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [(E)-[1-(1,3-benzothiazol-2-yl)-3-ethyl-2-oxoheptylidene]amino] 4-methylbenzenesulfonate |
| SMILES | CCCCC(CC)C(=O)/C(=N\OS(=O)(=O)c1ccc(C)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-4-6-9-17(5-2)22(26)21(23-24-19-10-7-8-11-20(19)30-23)25-29-31(27,28)18-14-12-16(3)13-15-18/h7-8,10-15,17H,4-6,9H2,1-3H3/b25-21+ |
| InChIKey | JMTDCFFRKSUGGI-NJNXFGOHSA-N |
| XLogP | 5.50 |
| TPSA | 85.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|