C21H25NO3S3 — CID 158932115
methyl 4-methylbenzenesulfonate;2-(3-methylsulfanylpent-2-en-2-yl)-1,3-benzothiazole (PubChem CID 158932115) has the molecular formula C21H25NO3S3 and a molecular weight of 435.64 g/mol. Its IUPAC name is methyl 4-methylbenzenesulfonate;2-(3-methylsulfanylpent-2-en-2-yl)-1,3-benzothiazole.
| Compound Name | methyl 4-methylbenzenesulfonate;2-(3-methylsulfanylpent-2-en-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 158932115 |
| Molecular Formula | C21H25NO3S3 |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl 4-methylbenzenesulfonate;2-(3-methylsulfanylpent-2-en-2-yl)-1,3-benzothiazole |
| SMILES | CCC(SC)=C(C)c1nc2ccccc2s1.COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15NS2.C8H10O3S/c1-4-11(15-3)9(2)13-14-10-7-5-6-8-12(10)16-13;1-7-3-5-8(6-4-7)12(9,10)11-2/h5-8H,4H2,1-3H3;3-6H,1-2H3 |
| InChIKey | JJESLKODJXLEDW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|