C12H17FN2O5 — CID 121325140
1-[(2R,3R,4R,5R)-4,5-dideuterio-5-[deuterio(hydroxy)methyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-5,6-dimethylpyrimidine-2,4-dione (PubChem CID 121325140) has the molecular formula C12H17FN2O5 and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4,5-dideuterio-5-[deuterio(hydroxy)methyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-5,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4,5-dideuterio-5-[deuterio(hydroxy)methyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-5,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121325140 |
| Molecular Formula | C12H17FN2O5 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4,5-dideuterio-5-[deuterio(hydroxy)methyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]-5,6-dimethylpyrimidine-2,4-dione |
| SMILES | [2H]C(O)[C@@]1([2H])O[C@@H](n2c(C)c(C)c(=O)[nH]c2=O)[C@](C)(F)[C@]1([2H])O |
| InChI | InChI=1S/C12H17FN2O5/c1-5-6(2)15(11(19)14-9(5)18)10-12(3,13)8(17)7(4-16)20-10/h7-8,10,16-17H,4H2,1-3H3,(H,14,18,19)/t7-,8-,10-,12-/m1/s1/i4D,7D,8D/t4?,7-,8-,10-,12- |
| InChIKey | MFBGHYOJVHHKHD-SPEWGITASA-N |
| XLogP | -0.87 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |