C6H8N4O — CID 121345580
9-methyl-2,3-dihydro-1H-purin-6-one (PubChem CID 121345580) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 9-methyl-2,3-dihydro-1H-purin-6-one.
| Compound Name | 9-methyl-2,3-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 121345580 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 9-methyl-2,3-dihydro-1H-purin-6-one |
| SMILES | Cn1cnc2c1NCNC2=O |
| InChI | InChI=1S/C6H8N4O/c1-10-3-9-4-5(10)7-2-8-6(4)11/h3,7H,2H2,1H3,(H,8,11) |
| InChIKey | YZNANVHMCHFYQG-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |