C7H10N4O — CID 174323807
3,7-dimethyl-8,9-dihydropurin-6-one (PubChem CID 174323807) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,7-dimethyl-8,9-dihydropurin-6-one.
| Compound Name | 3,7-dimethyl-8,9-dihydropurin-6-one |
|---|---|
| PubChem CID | 174323807 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3,7-dimethyl-8,9-dihydropurin-6-one |
| SMILES | CN1CNc2c1c(=O)ncn2C |
| InChI | InChI=1S/C7H10N4O/c1-10-3-8-6-5(10)7(12)9-4-11(6)2/h4,8H,3H2,1-2H3 |
| InChIKey | KALKIOYKWFYMSM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |