C7H10N4 — CID 142059765
2,9-dimethyl-3,6-dihydropurine (PubChem CID 142059765) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,9-dimethyl-3,6-dihydropurine.
| Compound Name | 2,9-dimethyl-3,6-dihydropurine |
|---|---|
| PubChem CID | 142059765 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2,9-dimethyl-3,6-dihydropurine |
| SMILES | CC1=NCc2ncn(C)c2N1 |
| InChI | InChI=1S/C7H10N4/c1-5-8-3-6-7(10-5)11(2)4-9-6/h4H,3H2,1-2H3,(H,8,10) |
| InChIKey | JXCLWMNLNCMFBL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |