C7H14N2 — CID 157422671
methane;1,4,5-trimethylimidazole (PubChem CID 157422671) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is methane;1,4,5-trimethylimidazole.
| Compound Name | methane;1,4,5-trimethylimidazole |
|---|---|
| PubChem CID | 157422671 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | methane;1,4,5-trimethylimidazole |
| SMILES | C.Cc1ncn(C)c1C |
| InChI | InChI=1S/C6H10N2.CH4/c1-5-6(2)8(3)4-7-5;/h4H,1-3H3;1H4 |
| InChIKey | BPPAMBBEEIOMHB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |