C7H11N5 — CID 148696430
N,9-dimethyl-2,3-dihydro-1H-purin-6-imine (PubChem CID 148696430) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is N,9-dimethyl-2,3-dihydro-1H-purin-6-imine.
| Compound Name | N,9-dimethyl-2,3-dihydro-1H-purin-6-imine |
|---|---|
| PubChem CID | 148696430 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N,9-dimethyl-2,3-dihydro-1H-purin-6-imine |
| SMILES | C/N=C1\NCNc2c1ncn2C |
| InChI | InChI=1S/C7H11N5/c1-8-6-5-7(10-3-9-6)12(2)4-11-5/h4,10H,3H2,1-2H3,(H,8,9) |
| InChIKey | NUMWNKDHXFEVBP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|