C7H8N5Y+2 — CID 135843130
N,9-dimethyl-2,3-dihydropurin-2-id-6-imine;yttrium(3+) (PubChem CID 135843130) has the molecular formula C7H8N5Y+2 and a molecular weight of 251.08 g/mol. Its IUPAC name is N,9-dimethyl-2,3-dihydropurin-2-id-6-imine;yttrium(3+).
| Compound Name | N,9-dimethyl-2,3-dihydropurin-2-id-6-imine;yttrium(3+) |
|---|---|
| PubChem CID | 135843130 |
| Molecular Formula | C7H8N5Y+2 |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | N,9-dimethyl-2,3-dihydropurin-2-id-6-imine;yttrium(3+) |
| SMILES | C/N=c1\n[c-][nH]c2c1ncn2C.[Y+3] |
| InChI | InChI=1S/C7H8N5.Y/c1-8-6-5-7(10-3-9-6)12(2)4-11-5;/h4H,1-2H3,(H,8,9,10);/q-1;+3 |
| InChIKey | GLBUGSLOXSZUKS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|