C7H10FN5 — CID 167120993
2-fluoro-2,9-dimethyl-3H-purin-6-amine (PubChem CID 167120993) has the molecular formula C7H10FN5 and a molecular weight of 183.19 g/mol. Its IUPAC name is 2-fluoro-2,9-dimethyl-3H-purin-6-amine.
| Compound Name | 2-fluoro-2,9-dimethyl-3H-purin-6-amine |
|---|---|
| PubChem CID | 167120993 |
| Molecular Formula | C7H10FN5 |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-fluoro-2,9-dimethyl-3H-purin-6-amine |
| SMILES | Cn1cnc2c1NC(C)(F)N=C2N |
| InChI | InChI=1S/C7H10FN5/c1-7(8)11-5(9)4-6(12-7)13(2)3-10-4/h3,12H,1-2H3,(H2,9,11) |
| InChIKey | PXCDLBQKQUKNRD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|