C36H48IN3O4S — CID 121348559
3-ethylheptan-3-yl 2-[4-(1-benzothiophen-4-yl)-1-[4-[(2-oxo-1H-quinolin-7-yl)oxy]butyl]piperazin-1-ium-1-yl]acetate iodide (PubChem CID 121348559) has the molecular formula C36H48IN3O4S and a molecular weight of 745.77 g/mol. Its IUPAC name is 3-ethylheptan-3-yl 2-[4-(1-benzothiophen-4-yl)-1-[4-[(2-oxo-1H-quinolin-7-yl)oxy]butyl]piperazin-1-ium-1-yl]acetate iodide.
| Compound Name | 3-ethylheptan-3-yl 2-[4-(1-benzothiophen-4-yl)-1-[4-[(2-oxo-1H-quinolin-7-yl)oxy]butyl]piperazin-1-ium-1-yl]acetate iodide |
|---|---|
| PubChem CID | 121348559 |
| Molecular Formula | C36H48IN3O4S |
| Molecular Weight | 745.77 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | 3-ethylheptan-3-yl 2-[4-(1-benzothiophen-4-yl)-1-[4-[(2-oxo-1H-quinolin-7-yl)oxy]butyl]piperazin-1-ium-1-yl]acetate iodide |
| SMILES | CCCCC(CC)(CC)OC(=O)C[N+]1(CCCCOc2ccc3ccc(=O)[nH]c3c2)CCN(c2cccc3sccc23)CC1.[I-] |
| InChI | InChI=1S/C36H47N3O4S.HI/c1-4-7-18-36(5-2,6-3)43-35(41)27-39(22-19-38(20-23-39)32-11-10-12-33-30(32)17-25-44-33)21-8-9-24-42-29-15-13-28-14-16-34(40)37-31(28)26-29;/h10-17,25-26H,4-9,18-24,27H2,1-3H3;1H |
| InChIKey | USNCKMUYDUKPJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|