C20H20F3N5O — CID 121351816
3-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 121351816) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is 3-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | 3-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121351816 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-cyclopropyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | NC(=O)N1c2nc(-c3cccc(C(F)(F)F)c3)nc(C3CC3)c2N2CCCC1C2 |
| InChI | InChI=1S/C20H20F3N5O/c21-20(22,23)13-4-1-3-12(9-13)17-25-15(11-6-7-11)16-18(26-17)28(19(24)29)14-5-2-8-27(16)10-14/h1,3-4,9,11,14H,2,5-8,10H2,(H2,24,29) |
| InChIKey | GFSCKJGUPBGTKH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |