C27H32ClN7O4S — CID 121359567
4-chloro-5-(2-methyl-4-pyridinyl)-N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359567) has the molecular formula C27H32ClN7O4S and a molecular weight of 586.12 g/mol. Its IUPAC name is 4-chloro-5-(2-methyl-4-pyridinyl)-N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | 4-chloro-5-(2-methyl-4-pyridinyl)-N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359567 |
| Molecular Formula | C27H32ClN7O4S |
| Molecular Weight | 586.12 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 4-chloro-5-(2-methyl-4-pyridinyl)-N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | Cc1cc(-c2nc3c(cc2Cl)N2CCC(C2)N3C(=O)Nc2cc(OCCCCOC(C)(C)OS)ncn2)ccn1 |
| InChI | InChI=1S/C27H32ClN7O4S/c1-17-12-18(6-8-29-17)24-20(28)13-21-25(33-24)35(19-7-9-34(21)15-19)26(36)32-22-14-23(31-16-30-22)37-10-4-5-11-38-27(2,3)39-40/h6,8,12-14,16,19,40H,4-5,7,9-11,15H2,1-3H3,(H,30,31,32,36) |
| InChIKey | YQDVVQWMHBLPQD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.12 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|