C15H24O6 — CID 121370107
[(3S,4S,6R)-3,5-dihydroxy-4-methyl-6-prop-2-ynoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 121370107) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(3S,4S,6R)-3,5-dihydroxy-4-methyl-6-prop-2-ynoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3S,4S,6R)-3,5-dihydroxy-4-methyl-6-prop-2-ynoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 121370107 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3S,4S,6R)-3,5-dihydroxy-4-methyl-6-prop-2-ynoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C#CCO[C@@H]1OC(COC(=O)C(C)(C)C)[C@@H](O)[C@H](C)C1O |
| InChI | InChI=1S/C15H24O6/c1-6-7-19-13-12(17)9(2)11(16)10(21-13)8-20-14(18)15(3,4)5/h1,9-13,16-17H,7-8H2,2-5H3/t9-,10?,11-,12?,13+/m0/s1 |
| InChIKey | XGAPTUVXULPETF-MWUVIEDJSA-N |
| XLogP | 0.31 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|