C19H29N — CID 121373940
(2E,4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 121373940) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (2E,4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373940 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2E,4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C=C/CN)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H29N/c1-16(10-7-5-6-8-15-20)12-13-18-17(2)11-9-14-19(18,3)4/h5-8,10,12-13H,9,11,14-15,20H2,1-4H3/b7-5+,8-6+,13-12+,16-10+ |
| InChIKey | GPIUDAUUJCPYIF-JUZDZPBYSA-N |
| XLogP | 5.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|