C18H29N — CID 121373938
(2E,4Z,6E)-5-tert-butyl-7-(2-methylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine (PubChem CID 121373938) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (2E,4Z,6E)-5-tert-butyl-7-(2-methylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z,6E)-5-tert-butyl-7-(2-methylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 121373938 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (2E,4Z,6E)-5-tert-butyl-7-(2-methylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine |
| SMILES | CC1=C(/C=C/C(=C/C=C/CN)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C18H29N/c1-15-9-5-6-10-16(15)12-13-17(18(2,3)4)11-7-8-14-19/h7-8,11-13H,5-6,9-10,14,19H2,1-4H3/b8-7+,13-12+,17-11- |
| InChIKey | JVEDXAVACOEHDB-JLUVVWDZSA-N |
| XLogP | 4.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|