C26H28N6O4S3 — CID 121401221
[6-[7-(1-azidobutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-2-pyridinyl] methanesulfonate (PubChem CID 121401221) has the molecular formula C26H28N6O4S3 and a molecular weight of 584.75 g/mol. Its IUPAC name is [6-[7-(1-azidobutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-2-pyridinyl] methanesulfonate.
| Compound Name | [6-[7-(1-azidobutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-2-pyridinyl] methanesulfonate |
|---|---|
| PubChem CID | 121401221 |
| Molecular Formula | C26H28N6O4S3 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | [6-[7-(1-azidobutan-2-ylamino)thianthren-1-yl]-4-morpholin-4-yl-2-pyridinyl] methanesulfonate |
| SMILES | CCC(CN=[N+]=[N-])Nc1ccc2c(c1)Sc1cccc(-c3cc(N4CCOCC4)cc(OS(C)(=O)=O)n3)c1S2 |
| InChI | InChI=1S/C26H28N6O4S3/c1-3-17(16-28-31-27)29-18-7-8-22-24(13-18)37-23-6-4-5-20(26(23)38-22)21-14-19(32-9-11-35-12-10-32)15-25(30-21)36-39(2,33)34/h4-8,13-15,17,29H,3,9-12,16H2,1-2H3 |
| InChIKey | IHNLLBODWRARIN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|