About 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole
5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole (PubChem CID 121402875) has the molecular formula C17H12Cl3N
and a molecular weight of 336.65 g/mol. Its IUPAC name is 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole |
| PubChem CID | 121402875 |
| Molecular Formula | C17H12Cl3N |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl3N/c1-10-13(14-9-12(18)4-7-17(14)21-10)5-2-11-3-6-15(19)16(20)8-11/h2-9,21H,1H3/b5-2+ |
| InChIKey | VVZQOCHEFOVSIK-GORDUTHDSA-N |
| XLogP | 6.61 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole?
The IUPAC name of 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole (CID 121402875) is 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole.
What is the SMILES notation for 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole?
The canonical SMILES for 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole is Cc1[nH]c2ccc(Cl)cc2c1/C=C/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole?
The InChIKey is VVZQOCHEFOVSIK-GORDUTHDSA-N. The full InChI is InChI=1S/C17H12Cl3N/c1-10-13(14-9-12(18)4-7-17(14)21-10)5-2-11-3-6-15(19)16(20)8-11/h2-9,21H,1H3/b5-2+.
What are the key properties of 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole?
5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole has a molecular weight of 336.65 g/mol, XLogP of 6.61, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-methyl-1H-indole is sourced from PubChem (CID 121402875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).