C17H15F4N3O3 — CID 121404769
2-[3-fluoro-4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrimidine-5-carbaldehyde (PubChem CID 121404769) has the molecular formula C17H15F4N3O3 and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrimidine-5-carbaldehyde.
| Compound Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 121404769 |
| Molecular Formula | C17H15F4N3O3 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1cnc(N2CCC(Oc3ccc(OC(F)(F)F)cc3)C(F)C2)nc1 |
| InChI | InChI=1S/C17H15F4N3O3/c18-14-9-24(16-22-7-11(10-25)8-23-16)6-5-15(14)26-12-1-3-13(4-2-12)27-17(19,20)21/h1-4,7-8,10,14-15H,5-6,9H2 |
| InChIKey | VWAARRZDGACGSB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|