C13H12BrF2N3O2 — CID 121404935
2-[[(2R,4S)-2-(bromomethyl)-4-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methyl]triazole (PubChem CID 121404935) has the molecular formula C13H12BrF2N3O2 and a molecular weight of 360.16 g/mol. Its IUPAC name is 2-[[(2R,4S)-2-(bromomethyl)-4-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methyl]triazole.
| Compound Name | 2-[[(2R,4S)-2-(bromomethyl)-4-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methyl]triazole |
|---|---|
| PubChem CID | 121404935 |
| Molecular Formula | C13H12BrF2N3O2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[[(2R,4S)-2-(bromomethyl)-4-(2,4-difluorophenyl)-1,3-dioxolan-4-yl]methyl]triazole |
| SMILES | Fc1ccc([C@]2(Cn3nccn3)CO[C@@H](CBr)O2)c(F)c1 |
| InChI | InChI=1S/C13H12BrF2N3O2/c14-6-12-20-8-13(21-12,7-19-17-3-4-18-19)10-2-1-9(15)5-11(10)16/h1-5,12H,6-8H2/t12-,13+/m1/s1 |
| InChIKey | WMSQRJVKFBQBDA-OLZOCXBDSA-N |
| XLogP | 2.22 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|