C31H40N4O4 — CID 121406510
methyl 1-[(2S)-2-amino-3-[4-[5-(4-heptoxyphenyl)-1,2-dihydropyrimidin-2-yl]phenyl]propanoyl]azetidine-3-carboxylate (PubChem CID 121406510) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is methyl 1-[(2S)-2-amino-3-[4-[5-(4-heptoxyphenyl)-1,2-dihydropyrimidin-2-yl]phenyl]propanoyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[(2S)-2-amino-3-[4-[5-(4-heptoxyphenyl)-1,2-dihydropyrimidin-2-yl]phenyl]propanoyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 121406510 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | methyl 1-[(2S)-2-amino-3-[4-[5-(4-heptoxyphenyl)-1,2-dihydropyrimidin-2-yl]phenyl]propanoyl]azetidine-3-carboxylate |
| SMILES | CCCCCCCOc1ccc(C2=CNC(c3ccc(C[C@H](N)C(=O)N4CC(C(=O)OC)C4)cc3)N=C2)cc1 |
| InChI | InChI=1S/C31H40N4O4/c1-3-4-5-6-7-16-39-27-14-12-23(13-15-27)25-18-33-29(34-19-25)24-10-8-22(9-11-24)17-28(32)30(36)35-20-26(21-35)31(37)38-2/h8-15,18-19,26,28-29,33H,3-7,16-17,20-21,32H2,1-2H3/t28-,29?/m0/s1 |
| InChIKey | BPMPIFRVGYZJEP-XLTVJXRZSA-N |
| XLogP | 4.25 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|