C19H21FN2O2 — CID 121411225
[2-(3-fluorophenyl)-4-methylphenyl]-[[(3R)-pyrrolidin-3-yl]methyl]carbamic acid (PubChem CID 121411225) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-4-methylphenyl]-[[(3R)-pyrrolidin-3-yl]methyl]carbamic acid.
| Compound Name | [2-(3-fluorophenyl)-4-methylphenyl]-[[(3R)-pyrrolidin-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 121411225 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [2-(3-fluorophenyl)-4-methylphenyl]-[[(3R)-pyrrolidin-3-yl]methyl]carbamic acid |
| SMILES | Cc1ccc(N(C[C@@H]2CCNC2)C(=O)O)c(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H21FN2O2/c1-13-5-6-18(17(9-13)15-3-2-4-16(20)10-15)22(19(23)24)12-14-7-8-21-11-14/h2-6,9-10,14,21H,7-8,11-12H2,1H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | QWJDCKHMXUKOJP-CQSZACIVSA-N |
| XLogP | 3.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |