C18H18Cl2N2O2 — CID 121411494
[2-(3,5-dichlorophenyl)phenyl]-(pyrrolidin-3-ylmethyl)carbamic acid (PubChem CID 121411494) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is [2-(3,5-dichlorophenyl)phenyl]-(pyrrolidin-3-ylmethyl)carbamic acid.
| Compound Name | [2-(3,5-dichlorophenyl)phenyl]-(pyrrolidin-3-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 121411494 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-(3,5-dichlorophenyl)phenyl]-(pyrrolidin-3-ylmethyl)carbamic acid |
| SMILES | O=C(O)N(CC1CCNC1)c1ccccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-14-7-13(8-15(20)9-14)16-3-1-2-4-17(16)22(18(23)24)11-12-5-6-21-10-12/h1-4,7-9,12,21H,5-6,10-11H2,(H,23,24) |
| InChIKey | DYCNJSXWTBRVPT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |