C20H23ClN4O — CID 121416337
(1S)-2-[[2-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)cyclopropyl]methoxy]-1-phenylethanamine (PubChem CID 121416337) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is (1S)-2-[[2-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)cyclopropyl]methoxy]-1-phenylethanamine.
| Compound Name | (1S)-2-[[2-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)cyclopropyl]methoxy]-1-phenylethanamine |
|---|---|
| PubChem CID | 121416337 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (1S)-2-[[2-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)cyclopropyl]methoxy]-1-phenylethanamine |
| SMILES | CCn1ncc2cc(Cl)nc(C3CC3COC[C@@H](N)c3ccccc3)c21 |
| InChI | InChI=1S/C20H23ClN4O/c1-2-25-20-14(10-23-25)9-18(21)24-19(20)16-8-15(16)11-26-12-17(22)13-6-4-3-5-7-13/h3-7,9-10,15-17H,2,8,11-12,22H2,1H3/t15?,16?,17-/m1/s1 |
| InChIKey | XRAIEMMXCFUBII-OFLPRAFFSA-N |
| XLogP | 3.92 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|