C20H25ClN6O — CID 121416339
[5-[(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)amino]-1-phenylpentyl]urea (PubChem CID 121416339) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is [5-[(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)amino]-1-phenylpentyl]urea.
| Compound Name | [5-[(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)amino]-1-phenylpentyl]urea |
|---|---|
| PubChem CID | 121416339 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [5-[(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)amino]-1-phenylpentyl]urea |
| SMILES | CCn1ncc2cc(Cl)nc(NCCCCC(NC(N)=O)c3ccccc3)c21 |
| InChI | InChI=1S/C20H25ClN6O/c1-2-27-18-15(13-24-27)12-17(21)26-19(18)23-11-7-6-10-16(25-20(22)28)14-8-4-3-5-9-14/h3-5,8-9,12-13,16H,2,6-7,10-11H2,1H3,(H,23,26)(H3,22,25,28) |
| InChIKey | MATKOLZXBNPICD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|