C20H23ClN4O3 — CID 121416332
[2-[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propoxy]-1-phenylethyl]carbamic acid (PubChem CID 121416332) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is [2-[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propoxy]-1-phenylethyl]carbamic acid.
| Compound Name | [2-[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propoxy]-1-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 121416332 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [2-[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propoxy]-1-phenylethyl]carbamic acid |
| SMILES | CCn1ncc2cc(Cl)nc(CCCOCC(NC(=O)O)c3ccccc3)c21 |
| InChI | InChI=1S/C20H23ClN4O3/c1-2-25-19-15(12-22-25)11-18(21)23-16(19)9-6-10-28-13-17(24-20(26)27)14-7-4-3-5-8-14/h3-5,7-8,11-12,17,24H,2,6,9-10,13H2,1H3,(H,26,27) |
| InChIKey | LAICHSWBCDVLDE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|