C19H23ClN4O2 — CID 121416372
1-[(2S)-2-amino-2-phenylethoxy]-3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propan-2-ol (PubChem CID 121416372) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-[(2S)-2-amino-2-phenylethoxy]-3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propan-2-ol.
| Compound Name | 1-[(2S)-2-amino-2-phenylethoxy]-3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propan-2-ol |
|---|---|
| PubChem CID | 121416372 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[(2S)-2-amino-2-phenylethoxy]-3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)propan-2-ol |
| SMILES | CCn1ncc2cc(Cl)nc(CC(O)COC[C@@H](N)c3ccccc3)c21 |
| InChI | InChI=1S/C19H23ClN4O2/c1-2-24-19-14(10-22-24)8-18(20)23-17(19)9-15(25)11-26-12-16(21)13-6-4-3-5-7-13/h3-8,10,15-16,25H,2,9,11-12,21H2,1H3/t15?,16-/m1/s1 |
| InChIKey | MITWAYCWTSSDOZ-OEMAIJDKSA-N |
| XLogP | 2.72 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|