C24H29ClN4O4 — CID 140875612
tert-butyl N-[(1S)-2-[[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)oxiran-2-yl]methoxy]-1-phenylethyl]carbamate (PubChem CID 140875612) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)oxiran-2-yl]methoxy]-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)oxiran-2-yl]methoxy]-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 140875612 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | tert-butyl N-[(1S)-2-[[3-(5-chloro-1-ethylpyrazolo[3,4-c]pyridin-7-yl)oxiran-2-yl]methoxy]-1-phenylethyl]carbamate |
| SMILES | CCn1ncc2cc(Cl)nc(C3OC3COC[C@@H](NC(=O)OC(C)(C)C)c3ccccc3)c21 |
| InChI | InChI=1S/C24H29ClN4O4/c1-5-29-21-16(12-26-29)11-19(25)28-20(21)22-18(32-22)14-31-13-17(15-9-7-6-8-10-15)27-23(30)33-24(2,3)4/h6-12,17-18,22H,5,13-14H2,1-4H3,(H,27,30)/t17-,18?,22?/m1/s1 |
| InChIKey | ZTCTXEUPBPLJDZ-PDDLGQBUSA-N |
| XLogP | 4.83 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|