C32H24F5NO6 — CID 121418835
(2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)-2-[2-(4-phenylphenyl)acetyl]oxybutanoate (PubChem CID 121418835) has the molecular formula C32H24F5NO6 and a molecular weight of 613.54 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)-2-[2-(4-phenylphenyl)acetyl]oxybutanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)-2-[2-(4-phenylphenyl)acetyl]oxybutanoate |
|---|---|
| PubChem CID | 121418835 |
| Molecular Formula | C32H24F5NO6 |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(phenylmethoxycarbonylamino)-2-[2-(4-phenylphenyl)acetyl]oxybutanoate |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)OC(CCNC(=O)OCc1ccccc1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H24F5NO6/c33-25-26(34)28(36)30(29(37)27(25)35)44-31(40)23(15-16-38-32(41)42-18-20-7-3-1-4-8-20)43-24(39)17-19-11-13-22(14-12-19)21-9-5-2-6-10-21/h1-14,23H,15-18H2,(H,38,41) |
| InChIKey | LDTIPEPKYUYTTB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|