C10H15ClN3O13P3 — CID 121429158
[[(2R,3S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 121429158) has the molecular formula C10H15ClN3O13P3 and a molecular weight of 513.61 g/mol. Its IUPAC name is [[(2R,3S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121429158 |
| Molecular Formula | C10H15ClN3O13P3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | [[(2R,3S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-3-hydroxy-3H-furan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ccn(C2=C[C@H](O)[C@@](CCl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C10H15ClN3O13P3/c11-4-10(5-24-29(20,21)27-30(22,23)26-28(17,18)19)6(15)3-8(25-10)14-2-1-7(12)13-9(14)16/h1-3,6,15H,4-5H2,(H,20,21)(H,22,23)(H2,12,13,16)(H2,17,18,19)/t6-,10+/m0/s1 |
| InChIKey | RDOXMQCHONMPRI-QUBYGPBYSA-N |
| XLogP | -0.66 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|