C24H27ClF3NO — CID 121430072
4-[(4-chlorophenyl)methyl]-1-[4-[2-(trifluoromethyl)phenyl]butyl]piperidine-4-carbaldehyde (PubChem CID 121430072) has the molecular formula C24H27ClF3NO and a molecular weight of 437.93 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-1-[4-[2-(trifluoromethyl)phenyl]butyl]piperidine-4-carbaldehyde.
| Compound Name | 4-[(4-chlorophenyl)methyl]-1-[4-[2-(trifluoromethyl)phenyl]butyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 121430072 |
| Molecular Formula | C24H27ClF3NO |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-1-[4-[2-(trifluoromethyl)phenyl]butyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1(Cc2ccc(Cl)cc2)CCN(CCCCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H27ClF3NO/c25-21-10-8-19(9-11-21)17-23(18-30)12-15-29(16-13-23)14-4-3-6-20-5-1-2-7-22(20)24(26,27)28/h1-2,5,7-11,18H,3-4,6,12-17H2 |
| InChIKey | CUCJURGECOVJST-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|