C19H19BrClN5 — CID 121439522
4-[[8-bromo-4-(butylamino)quinazolin-2-yl]amino]benzonitrile;hydrochloride (PubChem CID 121439522) has the molecular formula C19H19BrClN5 and a molecular weight of 432.75 g/mol. Its IUPAC name is 4-[[8-bromo-4-(butylamino)quinazolin-2-yl]amino]benzonitrile;hydrochloride.
| Compound Name | 4-[[8-bromo-4-(butylamino)quinazolin-2-yl]amino]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 121439522 |
| Molecular Formula | C19H19BrClN5 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 4-[[8-bromo-4-(butylamino)quinazolin-2-yl]amino]benzonitrile;hydrochloride |
| SMILES | CCCCNc1nc(Nc2ccc(C#N)cc2)nc2c(Br)cccc12.Cl |
| InChI | InChI=1S/C19H18BrN5.ClH/c1-2-3-11-22-18-15-5-4-6-16(20)17(15)24-19(25-18)23-14-9-7-13(12-21)8-10-14;/h4-10H,2-3,11H2,1H3,(H2,22,23,24,25);1H |
| InChIKey | PMIFJISQRUMJKI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|