C18H19N5Sn — CID 140735823
4-[(4-amino-8-trimethylstannylquinazolin-2-yl)amino]benzonitrile (PubChem CID 140735823) has the molecular formula C18H19N5Sn and a molecular weight of 424.10 g/mol. Its IUPAC name is 4-[(4-amino-8-trimethylstannylquinazolin-2-yl)amino]benzonitrile.
| Compound Name | 4-[(4-amino-8-trimethylstannylquinazolin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 140735823 |
| Molecular Formula | C18H19N5Sn |
| Molecular Weight | 424.10 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 4-[(4-amino-8-trimethylstannylquinazolin-2-yl)amino]benzonitrile |
| SMILES | C[Sn](C)(C)c1cccc2c(N)nc(Nc3ccc(C#N)cc3)nc12 |
| InChI | InChI=1S/C15H10N5.3CH3.Sn/c16-9-10-5-7-11(8-6-10)18-15-19-13-4-2-1-3-12(13)14(17)20-15;;;;/h1-3,5-8H,(H3,17,18,19,20);3*1H3; |
| InChIKey | MTMDGYVUDRJTIF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |