C27H22N6 — CID 121439586
4-[[4-amino-8-[4-(1-cyanoprop-1-en-2-yl)-2,6-dimethylphenyl]quinazolin-2-yl]amino]benzonitrile (PubChem CID 121439586) has the molecular formula C27H22N6 and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-[[4-amino-8-[4-(1-cyanoprop-1-en-2-yl)-2,6-dimethylphenyl]quinazolin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-amino-8-[4-(1-cyanoprop-1-en-2-yl)-2,6-dimethylphenyl]quinazolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 121439586 |
| Molecular Formula | C27H22N6 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[[4-amino-8-[4-(1-cyanoprop-1-en-2-yl)-2,6-dimethylphenyl]quinazolin-2-yl]amino]benzonitrile |
| SMILES | CC(=CC#N)c1cc(C)c(-c2cccc3c(N)nc(Nc4ccc(C#N)cc4)nc23)c(C)c1 |
| InChI | InChI=1S/C27H22N6/c1-16(11-12-28)20-13-17(2)24(18(3)14-20)22-5-4-6-23-25(22)32-27(33-26(23)30)31-21-9-7-19(15-29)8-10-21/h4-11,13-14H,1-3H3,(H3,30,31,32,33) |
| InChIKey | DWPSHKNCOCYXSD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|