C21H30N4O2 — CID 121440247
2-cyclobutyl-N-ethyl-N-[2-[4-(2-hydroxypropan-2-yl)-5-methyltriazol-2-yl]ethyl]benzamide (PubChem CID 121440247) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-cyclobutyl-N-ethyl-N-[2-[4-(2-hydroxypropan-2-yl)-5-methyltriazol-2-yl]ethyl]benzamide.
| Compound Name | 2-cyclobutyl-N-ethyl-N-[2-[4-(2-hydroxypropan-2-yl)-5-methyltriazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 121440247 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-cyclobutyl-N-ethyl-N-[2-[4-(2-hydroxypropan-2-yl)-5-methyltriazol-2-yl]ethyl]benzamide |
| SMILES | CCN(CCn1nc(C)c(C(C)(C)O)n1)C(=O)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C21H30N4O2/c1-5-24(13-14-25-22-15(2)19(23-25)21(3,4)27)20(26)18-12-7-6-11-17(18)16-9-8-10-16/h6-7,11-12,16,27H,5,8-10,13-14H2,1-4H3 |
| InChIKey | YALYUHDVEKKLJS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |