C21H30F2N5O4P — CID 121440377
[4-[2-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]amino]ethoxy]-1,1-difluorobutyl]-methylphosphinic acid (PubChem CID 121440377) has the molecular formula C21H30F2N5O4P and a molecular weight of 485.47 g/mol. Its IUPAC name is [4-[2-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]amino]ethoxy]-1,1-difluorobutyl]-methylphosphinic acid.
| Compound Name | [4-[2-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]amino]ethoxy]-1,1-difluorobutyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 121440377 |
| Molecular Formula | C21H30F2N5O4P |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [4-[2-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]amino]ethoxy]-1,1-difluorobutyl]-methylphosphinic acid |
| SMILES | CC(C)(O)Cn1c(NCCOCCCC(F)(F)P(C)(=O)O)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C21H30F2N5O4P/c1-20(2,29)13-28-17-14-7-4-5-8-15(14)26-18(24)16(17)27-19(28)25-10-12-32-11-6-9-21(22,23)33(3,30)31/h4-5,7-8,29H,6,9-13H2,1-3H3,(H2,24,26)(H,25,27)(H,30,31) |
| InChIKey | ATIAWHDKXVDDIS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|