C17H16Br2O — CID 121446940
1-(2,7-dibromo-4,9-dimethylfluoren-9-yl)ethanol (PubChem CID 121446940) has the molecular formula C17H16Br2O and a molecular weight of 396.12 g/mol. Its IUPAC name is 1-(2,7-dibromo-4,9-dimethylfluoren-9-yl)ethanol.
| Compound Name | 1-(2,7-dibromo-4,9-dimethylfluoren-9-yl)ethanol |
|---|---|
| PubChem CID | 121446940 |
| Molecular Formula | C17H16Br2O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-(2,7-dibromo-4,9-dimethylfluoren-9-yl)ethanol |
| SMILES | Cc1cc(Br)cc2c1-c1ccc(Br)cc1C2(C)C(C)O |
| InChI | InChI=1S/C17H16Br2O/c1-9-6-12(19)8-15-16(9)13-5-4-11(18)7-14(13)17(15,3)10(2)20/h4-8,10,20H,1-3H3 |
| InChIKey | IZXWXPVHXFEFMN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |