C21H28O4 — CID 121458349
(2S,3S,4S)-3-phenoxy-4-phenylmethoxy-2-propoxypentan-1-ol (PubChem CID 121458349) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (2S,3S,4S)-3-phenoxy-4-phenylmethoxy-2-propoxypentan-1-ol.
| Compound Name | (2S,3S,4S)-3-phenoxy-4-phenylmethoxy-2-propoxypentan-1-ol |
|---|---|
| PubChem CID | 121458349 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (2S,3S,4S)-3-phenoxy-4-phenylmethoxy-2-propoxypentan-1-ol |
| SMILES | CCCO[C@@H](CO)[C@@H](Oc1ccccc1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C21H28O4/c1-3-14-23-20(15-22)21(25-19-12-8-5-9-13-19)17(2)24-16-18-10-6-4-7-11-18/h4-13,17,20-22H,3,14-16H2,1-2H3/t17-,20-,21-/m0/s1 |
| InChIKey | PUZXJSXKGPZAPM-YYWHXJBOSA-N |
| XLogP | 3.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |