C29H33NO5S — CID 121461511
(3Z,5E)-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-[1-(3-methoxypropyl)azetidin-3-yl]oxy-2-methylhepta-3,5-dien-1-one (PubChem CID 121461511) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is (3Z,5E)-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-[1-(3-methoxypropyl)azetidin-3-yl]oxy-2-methylhepta-3,5-dien-1-one.
| Compound Name | (3Z,5E)-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-[1-(3-methoxypropyl)azetidin-3-yl]oxy-2-methylhepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 121461511 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (3Z,5E)-1-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-5-[1-(3-methoxypropyl)azetidin-3-yl]oxy-2-methylhepta-3,5-dien-1-one |
| SMILES | C/C=C(\C=C/C(C)C(=O)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12)OC1CN(CCCOC)C1 |
| InChI | InChI=1S/C29H33NO5S/c1-4-23(35-24-17-30(18-24)14-5-15-34-3)12-6-19(2)28(33)27-25-13-11-22(32)16-26(25)36-29(27)20-7-9-21(31)10-8-20/h4,6-13,16,19,24,31-32H,5,14-15,17-18H2,1-3H3/b12-6-,23-4+ |
| InChIKey | MHZBCHAFCXSMFJ-XPVSQSLNSA-N |
| XLogP | 6.00 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|