C30H30N2O6S — CID 164612122
(E)-4-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethylamino]-N-(2-methoxyethyl)but-2-enamide (PubChem CID 164612122) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is (E)-4-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethylamino]-N-(2-methoxyethyl)but-2-enamide.
| Compound Name | (E)-4-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethylamino]-N-(2-methoxyethyl)but-2-enamide |
|---|---|
| PubChem CID | 164612122 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (E)-4-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethylamino]-N-(2-methoxyethyl)but-2-enamide |
| SMILES | COCCNC(=O)/C=C/CNCCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C30H30N2O6S/c1-37-17-16-32-27(35)3-2-14-31-15-18-38-24-11-6-20(7-12-24)29(36)28-25-13-10-23(34)19-26(25)39-30(28)21-4-8-22(33)9-5-21/h2-13,19,31,33-34H,14-18H2,1H3,(H,32,35)/b3-2+ |
| InChIKey | FDEWZLPPJGQZIE-NSCUHMNNSA-N |
| XLogP | 4.50 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|